2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid

C10H11F2NO2 — CID 117306246

IUPAC2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid
SMILESCCc1cc(F)c(F)c(C(N)C(=O)O)c1
InChIInChI=1S/C10H11F2NO2/c1-2-5-3-6(9(13)10(14)15)8(12)7(11)4-5/h3-4,9H,2,13H2,1H3,(H,14,15)
InChIKeyAHOBKFMQYDYHDM-UHFFFAOYSA-N
MW215.20 g/mol
LogP1.61
Rot. Bonds3

About 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid

2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid (PubChem CID 117306246) has the molecular formula C10H11F2NO2 and a molecular weight of 215.20 g/mol. Its IUPAC name is 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid.

Molecular Properties

Compound Name2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid
PubChem CID117306246
Molecular FormulaC10H11F2NO2
Molecular Weight215.20 g/mol
Exact Mass215.08
IUPAC Name2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid
SMILESCCc1cc(F)c(F)c(C(N)C(=O)O)c1
InChIInChI=1S/C10H11F2NO2/c1-2-5-3-6(9(13)10(14)15)8(12)7(11)4-5/h3-4,9H,2,13H2,1H3,(H,14,15)
InChIKeyAHOBKFMQYDYHDM-UHFFFAOYSA-N
XLogP1.61
TPSA63.32 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500215.20
LogP ≤ 51.61
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

methyl 2-(5-ethyl-2,3-difluorophenyl)-2-hydroxyacetate
CID 117332045
2-amino-2-(5-chloro-2,3-difluorophenyl)acetic acid
CID 84788280
2-amino-2-(5-bromo-2,3-difluorophenyl)acetic acid
CID 84807691
2-amino-2-[2-(dimethylamino)-5-ethylphenyl]acetic acid
CID 117115118
2-amino-2-(5-ethyl-2,3-dimethoxyphenyl)acetic acid
CID 117350532
2-amino-2-[3-bromo-2-fluoro-5-(methoxymethyl)phenyl]acetic acid
CID 117471361
2-(3-bromo-5-ethyl-2-fluorophenyl)propanoic acid
CID 117439532
(2R)-2-amino-2-(2-amino-3,5-difluorophenyl)acetic acid
CID 130632470
2-amino-2-(4-ethoxy-2-fluorophenyl)acetic acid
CID 84679537
methyl (2R)-2-amino-2-(2,3,5-trifluorophenyl)acetate;hydrochloride
CID 171224868
3-amino-1-(5-ethyl-2,3-difluorophenyl)propan-1-one
CID 117303820
2-amino-4-ethyl-5-(2,3,4,5-tetrafluorophenyl)hexanoic acid
CID 174498022

Frequently Asked Questions

What is the IUPAC name of 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid?
The IUPAC name of 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid (CID 117306246) is 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid.
What is the SMILES notation for 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid?
The canonical SMILES for 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid is CCc1cc(F)c(F)c(C(N)C(=O)O)c1.
What is the InChIKey of 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid?
The InChIKey is AHOBKFMQYDYHDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11F2NO2/c1-2-5-3-6(9(13)10(14)15)8(12)7(11)4-5/h3-4,9H,2,13H2,1H3,(H,14,15).
What are the key properties of 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid?
2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid has a molecular weight of 215.20 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(5-ethyl-2,3-difluorophenyl)acetic acid is sourced from PubChem (CID 117306246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).