C13H16N2O — CID 117308308
5-(piperidin-2-ylmethyl)-1,2-benzoxazole (PubChem CID 117308308) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 5-(piperidin-2-ylmethyl)-1,2-benzoxazole.
| Compound Name | 5-(piperidin-2-ylmethyl)-1,2-benzoxazole |
|---|---|
| PubChem CID | 117308308 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 5-(piperidin-2-ylmethyl)-1,2-benzoxazole |
| SMILES | c1cc2oncc2cc1CC1CCCCN1 |
| InChI | InChI=1S/C13H16N2O/c1-2-6-14-12(3-1)8-10-4-5-13-11(7-10)9-15-16-13/h4-5,7,9,12,14H,1-3,6,8H2 |
| InChIKey | SRJJCODSYBKBET-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |