C14H19NO — CID 117309958
2-(2,3-dimethyl-1H-indol-6-yl)-2-methylpropan-1-ol (PubChem CID 117309958) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 2-(2,3-dimethyl-1H-indol-6-yl)-2-methylpropan-1-ol.
| Compound Name | 2-(2,3-dimethyl-1H-indol-6-yl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 117309958 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 2-(2,3-dimethyl-1H-indol-6-yl)-2-methylpropan-1-ol |
| SMILES | Cc1[nH]c2cc(C(C)(C)CO)ccc2c1C |
| InChI | InChI=1S/C14H19NO/c1-9-10(2)15-13-7-11(5-6-12(9)13)14(3,4)8-16/h5-7,15-16H,8H2,1-4H3 |
| InChIKey | UKIMZGOJOBGHTQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|