C11H14N2O — CID 117281905
2-(1H-indazol-5-yl)-2-methylpropan-1-ol (PubChem CID 117281905) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2-(1H-indazol-5-yl)-2-methylpropan-1-ol.
| Compound Name | 2-(1H-indazol-5-yl)-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 117281905 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2-(1H-indazol-5-yl)-2-methylpropan-1-ol |
| SMILES | CC(C)(CO)c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C11H14N2O/c1-11(2,7-14)9-3-4-10-8(5-9)6-12-13-10/h3-6,14H,7H2,1-2H3,(H,12,13) |
| InChIKey | RYZFMFLZRYOTLD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |