C15H24I2O2Si — CID 11731005
2,2-diethyl-1,3-diiodo-5,5-bis(methoxymethyl)-4,6-dihydrocyclopenta[c]silole (PubChem CID 11731005) has the molecular formula C15H24I2O2Si and a molecular weight of 518.25 g/mol. Its IUPAC name is 2,2-diethyl-1,3-diiodo-5,5-bis(methoxymethyl)-4,6-dihydrocyclopenta[c]silole.
| Compound Name | 2,2-diethyl-1,3-diiodo-5,5-bis(methoxymethyl)-4,6-dihydrocyclopenta[c]silole |
|---|---|
| PubChem CID | 11731005 |
| Molecular Formula | C15H24I2O2Si |
| Molecular Weight | 518.25 g/mol |
| Exact Mass | 517.96 |
| IUPAC Name | 2,2-diethyl-1,3-diiodo-5,5-bis(methoxymethyl)-4,6-dihydrocyclopenta[c]silole |
| SMILES | CC[Si]1(CC)C(I)=C2CC(COC)(COC)CC2=C1I |
| InChI | InChI=1S/C15H24I2O2Si/c1-5-20(6-2)13(16)11-7-15(9-18-3,10-19-4)8-12(11)14(20)17/h5-10H2,1-4H3 |
| InChIKey | CICQPZKUMOSACM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.25 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|