C17H32I2O2Si2 — CID 177429370
[(E)-iodo-[(2Z)-2-[iodo(trimethylsilyl)methylidene]-4,4-bis(methoxymethyl)cyclopentylidene]methyl]-trimethylsilane (PubChem CID 177429370) has the molecular formula C17H32I2O2Si2 and a molecular weight of 578.42 g/mol. Its IUPAC name is [(E)-iodo-[(2Z)-2-[iodo(trimethylsilyl)methylidene]-4,4-bis(methoxymethyl)cyclopentylidene]methyl]-trimethylsilane.
| Compound Name | [(E)-iodo-[(2Z)-2-[iodo(trimethylsilyl)methylidene]-4,4-bis(methoxymethyl)cyclopentylidene]methyl]-trimethylsilane |
|---|---|
| PubChem CID | 177429370 |
| Molecular Formula | C17H32I2O2Si2 |
| Molecular Weight | 578.42 g/mol |
| Exact Mass | 578.00 |
| IUPAC Name | [(E)-iodo-[(2Z)-2-[iodo(trimethylsilyl)methylidene]-4,4-bis(methoxymethyl)cyclopentylidene]methyl]-trimethylsilane |
| SMILES | COCC1(COC)CC(=C(/I)[Si](C)(C)C)/C(=C(/I)[Si](C)(C)C)C1 |
| InChI | InChI=1S/C17H32I2O2Si2/c1-20-11-17(12-21-2)9-13(15(18)22(3,4)5)14(10-17)16(19)23(6,7)8/h9-12H2,1-8H3/b15-13-,16-14+ |
| InChIKey | UQOOOSVXYGOBTI-VCFJNTAESA-N |
| XLogP | 6.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.42 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|