C27H56O2Si3 — CID 135070408
[(Z)-[4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylidenecyclopentylidene]methyl]-triethylsilane (PubChem CID 135070408) has the molecular formula C27H56O2Si3 and a molecular weight of 497.00 g/mol. Its IUPAC name is [(Z)-[4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylidenecyclopentylidene]methyl]-triethylsilane.
| Compound Name | [(Z)-[4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylidenecyclopentylidene]methyl]-triethylsilane |
|---|---|
| PubChem CID | 135070408 |
| Molecular Formula | C27H56O2Si3 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | [(Z)-[4,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methylidenecyclopentylidene]methyl]-triethylsilane |
| SMILES | C=C1CC(CO[Si](C)(C)C(C)(C)C)(CO[Si](C)(C)C(C)(C)C)C/C1=C/[Si](CC)(CC)CC |
| InChI | InChI=1S/C27H56O2Si3/c1-15-32(16-2,17-3)20-24-19-27(18-23(24)4,21-28-30(11,12)25(5,6)7)22-29-31(13,14)26(8,9)10/h20H,4,15-19,21-22H2,1-3,5-14H3/b24-20- |
| InChIKey | DJOWPABIHQYSIL-GFMRDNFCSA-N |
| XLogP | 9.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 9.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|