C42H90O2Si3Sn — CID 164686642
trimethyl-[(Z)-[2-(tributylstannylmethyl)-4,4-bis[tri(propan-2-yl)silyloxymethyl]cyclopentylidene]methyl]silane (PubChem CID 164686642) has the molecular formula C42H90O2Si3Sn and a molecular weight of 830.15 g/mol. Its IUPAC name is trimethyl-[(Z)-[2-(tributylstannylmethyl)-4,4-bis[tri(propan-2-yl)silyloxymethyl]cyclopentylidene]methyl]silane.
| Compound Name | trimethyl-[(Z)-[2-(tributylstannylmethyl)-4,4-bis[tri(propan-2-yl)silyloxymethyl]cyclopentylidene]methyl]silane |
|---|---|
| PubChem CID | 164686642 |
| Molecular Formula | C42H90O2Si3Sn |
| Molecular Weight | 830.15 g/mol |
| Exact Mass | 830.53 |
| IUPAC Name | trimethyl-[(Z)-[2-(tributylstannylmethyl)-4,4-bis[tri(propan-2-yl)silyloxymethyl]cyclopentylidene]methyl]silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC1CC(CO[Si](C(C)C)(C(C)C)C(C)C)(CO[Si](C(C)C)(C(C)C)C(C)C)C/C1=C/[Si](C)(C)C |
| InChI | InChI=1S/C30H63O2Si3.3C4H9.Sn/c1-22(2)34(23(3)4,24(5)6)31-20-30(17-28(13)29(18-30)19-33(14,15)16)21-32-35(25(7)8,26(9)10)27(11)12;3*1-3-4-2;/h19,22-28H,13,17-18,20-21H2,1-12,14-16H3;3*1,3-4H2,2H3;/b29-19-;;;; |
| InChIKey | CFNBWXUPQAOBJF-YDGMWLNNSA-N |
| XLogP | 15.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 830.15 |
| LogP ≤ 5 | 15.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|