C24H50O2SiSn — CID 164686162
[(4Z)-1-(hydroxymethyl)-3-(tributylstannylmethyl)-4-(trimethylsilylmethylidene)cyclopentyl]methanol (PubChem CID 164686162) has the molecular formula C24H50O2SiSn and a molecular weight of 517.46 g/mol. Its IUPAC name is [(4Z)-1-(hydroxymethyl)-3-(tributylstannylmethyl)-4-(trimethylsilylmethylidene)cyclopentyl]methanol.
| Compound Name | [(4Z)-1-(hydroxymethyl)-3-(tributylstannylmethyl)-4-(trimethylsilylmethylidene)cyclopentyl]methanol |
|---|---|
| PubChem CID | 164686162 |
| Molecular Formula | C24H50O2SiSn |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 518.26 |
| IUPAC Name | [(4Z)-1-(hydroxymethyl)-3-(tributylstannylmethyl)-4-(trimethylsilylmethylidene)cyclopentyl]methanol |
| SMILES | CCCC[Sn](CCCC)(CCCC)CC1CC(CO)(CO)C/C1=C/[Si](C)(C)C |
| InChI | InChI=1S/C12H23O2Si.3C4H9.Sn/c1-10-5-12(8-13,9-14)6-11(10)7-15(2,3)4;3*1-3-4-2;/h7,10,13-14H,1,5-6,8-9H2,2-4H3;3*1,3-4H2,2H3;/b11-7-;;;; |
| InChIKey | LKFBRTPWZCJUKH-YIUUKBIWSA-N |
| XLogP | 7.02 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|