C12H24O2Si — CID 134964905
[(1R,2E,3S)-3-(hydroxymethyl)-3-methyl-2-(trimethylsilylmethylidene)cyclopentyl]methanol (PubChem CID 134964905) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is [(1R,2E,3S)-3-(hydroxymethyl)-3-methyl-2-(trimethylsilylmethylidene)cyclopentyl]methanol.
| Compound Name | [(1R,2E,3S)-3-(hydroxymethyl)-3-methyl-2-(trimethylsilylmethylidene)cyclopentyl]methanol |
|---|---|
| PubChem CID | 134964905 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | [(1R,2E,3S)-3-(hydroxymethyl)-3-methyl-2-(trimethylsilylmethylidene)cyclopentyl]methanol |
| SMILES | C[C@]1(CO)CC[C@@H](CO)/C1=C\[Si](C)(C)C |
| InChI | InChI=1S/C12H24O2Si/c1-12(9-14)6-5-10(7-13)11(12)8-15(2,3)4/h8,10,13-14H,5-7,9H2,1-4H3/b11-8+/t10-,12+/m0/s1 |
| InChIKey | CKKRHBFLTABMLY-MLHLWSAZSA-N |
| XLogP | 2.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|