C13H18N2O — CID 117311328
4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]butan-1-amine (PubChem CID 117311328) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]butan-1-amine.
| Compound Name | 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]butan-1-amine |
|---|---|
| PubChem CID | 117311328 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-[2-(4,5-dihydro-1,3-oxazol-2-yl)phenyl]butan-1-amine |
| SMILES | NCCCCc1ccccc1C1=NCCO1 |
| InChI | InChI=1S/C13H18N2O/c14-8-4-3-6-11-5-1-2-7-12(11)13-15-9-10-16-13/h1-2,5,7H,3-4,6,8-10,14H2 |
| InChIKey | CHDZJXUBTTVGKP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|