C13H17NO2 — CID 117312519
methyl 3-(1-aminocyclopropyl)-4,5-dimethylbenzoate (PubChem CID 117312519) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 3-(1-aminocyclopropyl)-4,5-dimethylbenzoate.
| Compound Name | methyl 3-(1-aminocyclopropyl)-4,5-dimethylbenzoate |
|---|---|
| PubChem CID | 117312519 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | methyl 3-(1-aminocyclopropyl)-4,5-dimethylbenzoate |
| SMILES | COC(=O)c1cc(C)c(C)c(C2(N)CC2)c1 |
| InChI | InChI=1S/C13H17NO2/c1-8-6-10(12(15)16-3)7-11(9(8)2)13(14)4-5-13/h6-7H,4-5,14H2,1-3H3 |
| InChIKey | JTEGRDNHMBLCCC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |