About methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate
methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate (PubChem CID 117340452) has the molecular formula C14H18O3
and a molecular weight of 234.29 g/mol. Its IUPAC name is methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate.
Analyze methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate?
The IUPAC name of methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate (CID 117340452) is methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate.
What is the SMILES notation for methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate?
The canonical SMILES for methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate is COC(=O)c1cc(C)c(C)c(CC2(O)CC2)c1.
What is the InChIKey of methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate?
The InChIKey is JAWIZQCMYDJGFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18O3/c1-9-6-11(13(15)17-3)7-12(10(9)2)8-14(16)4-5-14/h6-7,16H,4-5,8H2,1-3H3.
What are the key properties of methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate?
methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate has a molecular weight of 234.29 g/mol, XLogP of 2.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(1-hydroxycyclopropyl)methyl]-4,5-dimethylbenzoate is sourced from PubChem (CID 117340452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).