C13H16O5 — CID 117383572
methyl 4-hydroxy-5-[(1-hydroxycyclopropyl)methyl]-2-methoxybenzoate (PubChem CID 117383572) has the molecular formula C13H16O5 and a molecular weight of 252.27 g/mol. Its IUPAC name is methyl 4-hydroxy-5-[(1-hydroxycyclopropyl)methyl]-2-methoxybenzoate.
| Compound Name | methyl 4-hydroxy-5-[(1-hydroxycyclopropyl)methyl]-2-methoxybenzoate |
|---|---|
| PubChem CID | 117383572 |
| Molecular Formula | C13H16O5 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | methyl 4-hydroxy-5-[(1-hydroxycyclopropyl)methyl]-2-methoxybenzoate |
| SMILES | COC(=O)c1cc(CC2(O)CC2)c(O)cc1OC |
| InChI | InChI=1S/C13H16O5/c1-17-11-6-10(14)8(7-13(16)3-4-13)5-9(11)12(15)18-2/h5-6,14,16H,3-4,7H2,1-2H3 |
| InChIKey | PTEGFPSXTWACMW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |