C13H17NO2 — CID 117312655
methyl 5-[(E)-3-aminoprop-1-enyl]-2,4-dimethylbenzoate (PubChem CID 117312655) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is methyl 5-[(E)-3-aminoprop-1-enyl]-2,4-dimethylbenzoate.
| Compound Name | methyl 5-[(E)-3-aminoprop-1-enyl]-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 117312655 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | methyl 5-[(E)-3-aminoprop-1-enyl]-2,4-dimethylbenzoate |
| SMILES | COC(=O)c1cc(/C=C/CN)c(C)cc1C |
| InChI | InChI=1S/C13H17NO2/c1-9-7-10(2)12(13(15)16-3)8-11(9)5-4-6-14/h4-5,7-8H,6,14H2,1-3H3/b5-4+ |
| InChIKey | LYXJVJKRODGQPO-SNAWJCMRSA-N |
| XLogP | 2.06 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |