C11H13NO4 — CID 117319282
methyl 5-[(E)-3-aminoprop-1-enyl]-2,4-dihydroxybenzoate (PubChem CID 117319282) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is methyl 5-[(E)-3-aminoprop-1-enyl]-2,4-dihydroxybenzoate.
| Compound Name | methyl 5-[(E)-3-aminoprop-1-enyl]-2,4-dihydroxybenzoate |
|---|---|
| PubChem CID | 117319282 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | methyl 5-[(E)-3-aminoprop-1-enyl]-2,4-dihydroxybenzoate |
| SMILES | COC(=O)c1cc(/C=C/CN)c(O)cc1O |
| InChI | InChI=1S/C11H13NO4/c1-16-11(15)8-5-7(3-2-4-12)9(13)6-10(8)14/h2-3,5-6,13-14H,4,12H2,1H3/b3-2+ |
| InChIKey | BTZJLNBUETWNBS-NSCUHMNNSA-N |
| XLogP | 0.86 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |