C11H11NO5 — CID 170798414
5-(4-amino-4-oxobut-1-enyl)-2,4-dihydroxybenzoic acid (PubChem CID 170798414) has the molecular formula C11H11NO5 and a molecular weight of 237.21 g/mol. Its IUPAC name is 5-(4-amino-4-oxobut-1-enyl)-2,4-dihydroxybenzoic acid.
| Compound Name | 5-(4-amino-4-oxobut-1-enyl)-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 170798414 |
| Molecular Formula | C11H11NO5 |
| Molecular Weight | 237.21 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-(4-amino-4-oxobut-1-enyl)-2,4-dihydroxybenzoic acid |
| SMILES | NC(=O)CC=Cc1cc(C(=O)O)c(O)cc1O |
| InChI | InChI=1S/C11H11NO5/c12-10(15)3-1-2-6-4-7(11(16)17)9(14)5-8(6)13/h1-2,4-5,13-14H,3H2,(H2,12,15)(H,16,17) |
| InChIKey | WPUZLQUWVCXUNQ-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |