About 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile
5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile (PubChem CID 117315098) has the molecular formula C10H5F2N3O
and a molecular weight of 221.17 g/mol. Its IUPAC name is 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile.
Molecular Properties
| Compound Name | 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile |
| PubChem CID | 117315098 |
| Molecular Formula | C10H5F2N3O |
| Molecular Weight | 221.17 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile |
| SMILES | N#Cc1cc(-c2cc(N)on2)c(F)cc1F |
| InChI | InChI=1S/C10H5F2N3O/c11-7-2-8(12)6(1-5(7)4-13)9-3-10(14)16-15-9/h1-3H,14H2 |
| InChIKey | UWCHBGIMQOPZJU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile?
The IUPAC name of 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile (CID 117315098) is 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile.
What is the SMILES notation for 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile?
The canonical SMILES for 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile is N#Cc1cc(-c2cc(N)on2)c(F)cc1F.
What is the InChIKey of 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile?
The InChIKey is UWCHBGIMQOPZJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H5F2N3O/c11-7-2-8(12)6(1-5(7)4-13)9-3-10(14)16-15-9/h1-3H,14H2.
What are the key properties of 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile?
5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile has a molecular weight of 221.17 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-amino-1,2-oxazol-3-yl)-2,4-difluorobenzonitrile is sourced from PubChem (CID 117315098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).