C10H9FN2O3 — CID 136968465
2-(5-amino-1,2-oxazol-3-yl)-5-fluoro-4-methoxyphenol (PubChem CID 136968465) has the molecular formula C10H9FN2O3 and a molecular weight of 224.19 g/mol. Its IUPAC name is 2-(5-amino-1,2-oxazol-3-yl)-5-fluoro-4-methoxyphenol.
| Compound Name | 2-(5-amino-1,2-oxazol-3-yl)-5-fluoro-4-methoxyphenol |
|---|---|
| PubChem CID | 136968465 |
| Molecular Formula | C10H9FN2O3 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-(5-amino-1,2-oxazol-3-yl)-5-fluoro-4-methoxyphenol |
| SMILES | COc1cc(-c2cc(N)on2)c(O)cc1F |
| InChI | InChI=1S/C10H9FN2O3/c1-15-9-2-5(8(14)3-6(9)11)7-4-10(12)16-13-7/h2-4,14H,12H2,1H3 |
| InChIKey | YTSZUNMFRHLHJK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |