C10H8F2N2O3 — CID 117356931
3-(5-amino-1,2-oxazol-3-yl)-2,4-difluoro-5-methoxyphenol (PubChem CID 117356931) has the molecular formula C10H8F2N2O3 and a molecular weight of 242.18 g/mol. Its IUPAC name is 3-(5-amino-1,2-oxazol-3-yl)-2,4-difluoro-5-methoxyphenol.
| Compound Name | 3-(5-amino-1,2-oxazol-3-yl)-2,4-difluoro-5-methoxyphenol |
|---|---|
| PubChem CID | 117356931 |
| Molecular Formula | C10H8F2N2O3 |
| Molecular Weight | 242.18 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3-(5-amino-1,2-oxazol-3-yl)-2,4-difluoro-5-methoxyphenol |
| SMILES | COc1cc(O)c(F)c(-c2cc(N)on2)c1F |
| InChI | InChI=1S/C10H8F2N2O3/c1-16-6-3-5(15)9(11)8(10(6)12)4-2-7(13)17-14-4/h2-3,15H,13H2,1H3 |
| InChIKey | MZQXWFWTIFQAMH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.18 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |