About methyl 9-bromooctadecanoate
methyl 9-bromooctadecanoate (PubChem CID 11731588) has the molecular formula C19H37BrO2
and a molecular weight of 377.41 g/mol. Its IUPAC name is methyl 9-bromooctadecanoate.
Molecular Properties
| Compound Name | methyl 9-bromooctadecanoate |
| PubChem CID | 11731588 |
| Molecular Formula | C19H37BrO2 |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | methyl 9-bromooctadecanoate |
| SMILES | CCCCCCCCCC(Br)CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H37BrO2/c1-3-4-5-6-7-9-12-15-18(20)16-13-10-8-11-14-17-19(21)22-2/h18H,3-17H2,1-2H3 |
| InChIKey | QTOCKWQGWXDIBK-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-bromooctadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-bromooctadecanoate?
The IUPAC name of methyl 9-bromooctadecanoate (CID 11731588) is methyl 9-bromooctadecanoate.
What is the SMILES notation for methyl 9-bromooctadecanoate?
The canonical SMILES for methyl 9-bromooctadecanoate is CCCCCCCCCC(Br)CCCCCCCC(=O)OC.
What is the InChIKey of methyl 9-bromooctadecanoate?
The InChIKey is QTOCKWQGWXDIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H37BrO2/c1-3-4-5-6-7-9-12-15-18(20)16-13-10-8-11-14-17-19(21)22-2/h18H,3-17H2,1-2H3.
What are the key properties of methyl 9-bromooctadecanoate?
methyl 9-bromooctadecanoate has a molecular weight of 377.41 g/mol, XLogP of 6.79, 16 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-bromooctadecanoate is sourced from PubChem (CID 11731588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).