C12H14O4 — CID 117317830
ethyl 2-(1,3-dihydro-2-benzofuran-5-yl)-2-hydroxyacetate (PubChem CID 117317830) has the molecular formula C12H14O4 and a molecular weight of 222.24 g/mol. Its IUPAC name is ethyl 2-(1,3-dihydro-2-benzofuran-5-yl)-2-hydroxyacetate.
| Compound Name | ethyl 2-(1,3-dihydro-2-benzofuran-5-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 117317830 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | ethyl 2-(1,3-dihydro-2-benzofuran-5-yl)-2-hydroxyacetate |
| SMILES | CCOC(=O)C(O)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C12H14O4/c1-2-16-12(14)11(13)8-3-4-9-6-15-7-10(9)5-8/h3-5,11,13H,2,6-7H2,1H3 |
| InChIKey | QVPLMKQCPKJOCA-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |