C20H12Cl2N2O3 — CID 11732090
(4Z)-4-[(6,7-dichloro-4-oxochromen-3-yl)methylidene]-5-methyl-2-phenylpyrazol-3-one (PubChem CID 11732090) has the molecular formula C20H12Cl2N2O3 and a molecular weight of 399.23 g/mol. Its IUPAC name is (4Z)-4-[(6,7-dichloro-4-oxochromen-3-yl)methylidene]-5-methyl-2-phenylpyrazol-3-one.
| Compound Name | (4Z)-4-[(6,7-dichloro-4-oxochromen-3-yl)methylidene]-5-methyl-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 11732090 |
| Molecular Formula | C20H12Cl2N2O3 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | (4Z)-4-[(6,7-dichloro-4-oxochromen-3-yl)methylidene]-5-methyl-2-phenylpyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C\c1coc2cc(Cl)c(Cl)cc2c1=O |
| InChI | InChI=1S/C20H12Cl2N2O3/c1-11-14(20(26)24(23-11)13-5-3-2-4-6-13)7-12-10-27-18-9-17(22)16(21)8-15(18)19(12)25/h2-10H,1H3/b14-7- |
| InChIKey | LHKGOHRHYQJQBB-AUWJEWJLSA-N |
| XLogP | 4.91 |
| TPSA | 62.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|