C23H23N3O3S — CID 1173217
1-(2,5-dimethoxyphenyl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]ethanone (PubChem CID 1173217) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-(2,5-dimethoxyphenyl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]ethanone.
| Compound Name | 1-(2,5-dimethoxyphenyl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]ethanone |
|---|---|
| PubChem CID | 1173217 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-(2,5-dimethoxyphenyl)-2-[(4,7,9-trimethyl-[1,2,4]triazolo[4,3-a]quinolin-1-yl)sulfanyl]ethanone |
| SMILES | COc1ccc(OC)c(C(=O)CSc2nnc3c(C)cc4cc(C)cc(C)c4n23)c1 |
| InChI | InChI=1S/C23H23N3O3S/c1-13-8-14(2)21-16(9-13)10-15(3)22-24-25-23(26(21)22)30-12-19(27)18-11-17(28-4)6-7-20(18)29-5/h6-11H,12H2,1-5H3 |
| InChIKey | NVYMJINNTUQKAR-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |