C18H30O8S — CID 11732257
dipropan-2-yl (4R,5R)-2-[(3S,4R,5R)-4-hydroxy-5-[(1R)-1-hydroxyethyl]thian-3-yl]-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 11732257) has the molecular formula C18H30O8S and a molecular weight of 406.50 g/mol. Its IUPAC name is dipropan-2-yl (4R,5R)-2-[(3S,4R,5R)-4-hydroxy-5-[(1R)-1-hydroxyethyl]thian-3-yl]-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dipropan-2-yl (4R,5R)-2-[(3S,4R,5R)-4-hydroxy-5-[(1R)-1-hydroxyethyl]thian-3-yl]-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 11732257 |
| Molecular Formula | C18H30O8S |
| Molecular Weight | 406.50 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | dipropan-2-yl (4R,5R)-2-[(3S,4R,5R)-4-hydroxy-5-[(1R)-1-hydroxyethyl]thian-3-yl]-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CC(C)OC(=O)[C@@H]1OC([C@H]2CSC[C@H]([C@@H](C)O)[C@H]2O)O[C@H]1C(=O)OC(C)C |
| InChI | InChI=1S/C18H30O8S/c1-8(2)23-16(21)14-15(17(22)24-9(3)4)26-18(25-14)12-7-27-6-11(10(5)19)13(12)20/h8-15,18-20H,6-7H2,1-5H3/t10-,11-,12+,13-,14-,15-/m1/s1 |
| InChIKey | WBGMZPHMIMBCCQ-QAUDVVSPSA-N |
| XLogP | 0.72 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.50 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |