C20H34O8S — CID 158305179
methyl (3R,4R,6R)-3-[(2S,5R,6S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-6-ethylsulfanyl-4-hydroxy-5-methyloxane-2-carboxylate (PubChem CID 158305179) has the molecular formula C20H34O8S and a molecular weight of 434.55 g/mol. Its IUPAC name is methyl (3R,4R,6R)-3-[(2S,5R,6S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-6-ethylsulfanyl-4-hydroxy-5-methyloxane-2-carboxylate.
| Compound Name | methyl (3R,4R,6R)-3-[(2S,5R,6S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-6-ethylsulfanyl-4-hydroxy-5-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 158305179 |
| Molecular Formula | C20H34O8S |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | methyl (3R,4R,6R)-3-[(2S,5R,6S)-3-acetyloxy-4,5,6-trimethyloxan-2-yl]oxy-6-ethylsulfanyl-4-hydroxy-5-methyloxane-2-carboxylate |
| SMILES | CCS[C@H]1OC(C(=O)OC)[C@H](O[C@@H]2O[C@@H](C)[C@H](C)C(C)C2OC(C)=O)[C@H](O)C1C |
| InChI | InChI=1S/C20H34O8S/c1-8-29-20-11(4)14(22)16(17(28-20)18(23)24-7)27-19-15(26-13(6)21)10(3)9(2)12(5)25-19/h9-12,14-17,19-20,22H,8H2,1-7H3/t9-,10?,11?,12+,14-,15?,16-,17?,19+,20-/m1/s1 |
| InChIKey | DIGNQPATFGLDQI-IJDHSPKDSA-N |
| XLogP | 1.97 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |