C13H11N3O — CID 117323198
3-(3-methylisoquinolin-7-yl)-1,2-oxazol-5-amine (PubChem CID 117323198) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 3-(3-methylisoquinolin-7-yl)-1,2-oxazol-5-amine.
| Compound Name | 3-(3-methylisoquinolin-7-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117323198 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 3-(3-methylisoquinolin-7-yl)-1,2-oxazol-5-amine |
| SMILES | Cc1cc2ccc(-c3cc(N)on3)cc2cn1 |
| InChI | InChI=1S/C13H11N3O/c1-8-4-9-2-3-10(5-11(9)7-15-8)12-6-13(14)17-16-12/h2-7H,14H2,1H3 |
| InChIKey | RQXXDNXZJWLYOJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |