C10H7N3OS — CID 117309227
3-(1,3-benzothiazol-6-yl)-1,2-oxazol-5-amine (PubChem CID 117309227) has the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. Its IUPAC name is 3-(1,3-benzothiazol-6-yl)-1,2-oxazol-5-amine.
| Compound Name | 3-(1,3-benzothiazol-6-yl)-1,2-oxazol-5-amine |
|---|---|
| PubChem CID | 117309227 |
| Molecular Formula | C10H7N3OS |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 3-(1,3-benzothiazol-6-yl)-1,2-oxazol-5-amine |
| SMILES | Nc1cc(-c2ccc3ncsc3c2)no1 |
| InChI | InChI=1S/C10H7N3OS/c11-10-4-8(13-14-10)6-1-2-7-9(3-6)15-5-12-7/h1-5H,11H2 |
| InChIKey | VPTYBSOOYFDJRU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |