C10H8ClNO3 — CID 117324273
4-chloro-3-(1-isocyanatocyclopropyl)benzene-1,2-diol (PubChem CID 117324273) has the molecular formula C10H8ClNO3 and a molecular weight of 225.63 g/mol. Its IUPAC name is 4-chloro-3-(1-isocyanatocyclopropyl)benzene-1,2-diol.
| Compound Name | 4-chloro-3-(1-isocyanatocyclopropyl)benzene-1,2-diol |
|---|---|
| PubChem CID | 117324273 |
| Molecular Formula | C10H8ClNO3 |
| Molecular Weight | 225.63 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 4-chloro-3-(1-isocyanatocyclopropyl)benzene-1,2-diol |
| SMILES | O=C=NC1(c2c(Cl)ccc(O)c2O)CC1 |
| InChI | InChI=1S/C10H8ClNO3/c11-6-1-2-7(14)9(15)8(6)10(3-4-10)12-5-13/h1-2,14-15H,3-4H2 |
| InChIKey | JLSNTLSIRHPXOY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.63 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|