C12H10ClNO3 — CID 117382433
6-chloro-5-(1-isocyanatocyclopropyl)-2,3-dihydro-1,4-benzodioxine (PubChem CID 117382433) has the molecular formula C12H10ClNO3 and a molecular weight of 251.67 g/mol. Its IUPAC name is 6-chloro-5-(1-isocyanatocyclopropyl)-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-chloro-5-(1-isocyanatocyclopropyl)-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 117382433 |
| Molecular Formula | C12H10ClNO3 |
| Molecular Weight | 251.67 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 6-chloro-5-(1-isocyanatocyclopropyl)-2,3-dihydro-1,4-benzodioxine |
| SMILES | O=C=NC1(c2c(Cl)ccc3c2OCCO3)CC1 |
| InChI | InChI=1S/C12H10ClNO3/c13-8-1-2-9-11(17-6-5-16-9)10(8)12(3-4-12)14-7-15/h1-2H,3-6H2 |
| InChIKey | ORKPOUSJKWVRTJ-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.67 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|