C16H19Br2NO2 — CID 11732485
(1R,5S,6S)-7,7-dibromo-2-[(4-methoxyphenyl)methyl]-1,5-dimethyl-2-azabicyclo[4.1.0]heptan-3-one (PubChem CID 11732485) has the molecular formula C16H19Br2NO2 and a molecular weight of 417.14 g/mol. Its IUPAC name is (1R,5S,6S)-7,7-dibromo-2-[(4-methoxyphenyl)methyl]-1,5-dimethyl-2-azabicyclo[4.1.0]heptan-3-one.
| Compound Name | (1R,5S,6S)-7,7-dibromo-2-[(4-methoxyphenyl)methyl]-1,5-dimethyl-2-azabicyclo[4.1.0]heptan-3-one |
|---|---|
| PubChem CID | 11732485 |
| Molecular Formula | C16H19Br2NO2 |
| Molecular Weight | 417.14 g/mol |
| Exact Mass | 414.98 |
| IUPAC Name | (1R,5S,6S)-7,7-dibromo-2-[(4-methoxyphenyl)methyl]-1,5-dimethyl-2-azabicyclo[4.1.0]heptan-3-one |
| SMILES | COc1ccc(CN2C(=O)C[C@H](C)[C@@H]3C(Br)(Br)[C@@]32C)cc1 |
| InChI | InChI=1S/C16H19Br2NO2/c1-10-8-13(20)19(15(2)14(10)16(15,17)18)9-11-4-6-12(21-3)7-5-11/h4-7,10,14H,8-9H2,1-3H3/t10-,14-,15+/m0/s1 |
| InChIKey | HUJVHLAFQAKZQI-NZVBXONLSA-N |
| XLogP | 3.94 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|