C24H34O7 — CID 11732818
[(1S,2R,3S,8R,10E,14S,15R)-2-acetyloxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] acetate (PubChem CID 11732818) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is [(1S,2R,3S,8R,10E,14S,15R)-2-acetyloxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] acetate.
| Compound Name | [(1S,2R,3S,8R,10E,14S,15R)-2-acetyloxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] acetate |
|---|---|
| PubChem CID | 11732818 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(1S,2R,3S,8R,10E,14S,15R)-2-acetyloxy-1,5,10,14-tetramethyl-6-oxo-7,18-dioxatricyclo[13.2.1.04,8]octadeca-4,10-dien-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)C2=C(C)C(=O)O[C@@H]2C/C(C)=C/CC[C@H](C)[C@H]2CC[C@]1(C)O2 |
| InChI | InChI=1S/C24H34O7/c1-13-8-7-9-14(2)18-10-11-24(6,31-18)22(29-17(5)26)21(28-16(4)25)20-15(3)23(27)30-19(20)12-13/h8,14,18-19,21-22H,7,9-12H2,1-6H3/b13-8+/t14-,18+,19+,21-,22+,24-/m0/s1 |
| InChIKey | QZBVUJFNAUZPBE-HOYXUBHQSA-N |
| XLogP | 3.80 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|