C12H14F2O2 — CID 117328612
1-[[2-(difluoromethyl)-5-methoxyphenyl]methyl]cyclopropan-1-ol (PubChem CID 117328612) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 1-[[2-(difluoromethyl)-5-methoxyphenyl]methyl]cyclopropan-1-ol.
| Compound Name | 1-[[2-(difluoromethyl)-5-methoxyphenyl]methyl]cyclopropan-1-ol |
|---|---|
| PubChem CID | 117328612 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 1-[[2-(difluoromethyl)-5-methoxyphenyl]methyl]cyclopropan-1-ol |
| SMILES | COc1ccc(C(F)F)c(CC2(O)CC2)c1 |
| InChI | InChI=1S/C12H14F2O2/c1-16-9-2-3-10(11(13)14)8(6-9)7-12(15)4-5-12/h2-3,6,11,15H,4-5,7H2,1H3 |
| InChIKey | SOROJVITAUFQNQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |