C11H13ClO3 — CID 117329398
1-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)propan-2-ol (PubChem CID 117329398) has the molecular formula C11H13ClO3 and a molecular weight of 228.67 g/mol. Its IUPAC name is 1-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)propan-2-ol.
| Compound Name | 1-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)propan-2-ol |
|---|---|
| PubChem CID | 117329398 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.67 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 1-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)propan-2-ol |
| SMILES | Cc1c(CC(C)O)cc(Cl)c2c1OCO2 |
| InChI | InChI=1S/C11H13ClO3/c1-6(13)3-8-4-9(12)11-10(7(8)2)14-5-15-11/h4,6,13H,3,5H2,1-2H3 |
| InChIKey | GIKRTKKGVQWSAI-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.67 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |