C10H11ClO3 — CID 84680593
1-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)ethanol (PubChem CID 84680593) has the molecular formula C10H11ClO3 and a molecular weight of 214.65 g/mol. Its IUPAC name is 1-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)ethanol.
| Compound Name | 1-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)ethanol |
|---|---|
| PubChem CID | 84680593 |
| Molecular Formula | C10H11ClO3 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 1-(7-chloro-4-methyl-1,3-benzodioxol-5-yl)ethanol |
| SMILES | Cc1c(C(C)O)cc(Cl)c2c1OCO2 |
| InChI | InChI=1S/C10H11ClO3/c1-5-7(6(2)12)3-8(11)10-9(5)13-4-14-10/h3,6,12H,4H2,1-2H3 |
| InChIKey | KMVWLUIUQXGOFX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |