C25H44O6Si — CID 11733359
[(1R,3S,5S,7R,8R)-7-methyl-11-oxo-3-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-4,12-dioxatricyclo[6.3.1.03,5]dodecan-7-yl] acetate (PubChem CID 11733359) has the molecular formula C25H44O6Si and a molecular weight of 468.71 g/mol. Its IUPAC name is [(1R,3S,5S,7R,8R)-7-methyl-11-oxo-3-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-4,12-dioxatricyclo[6.3.1.03,5]dodecan-7-yl] acetate.
| Compound Name | [(1R,3S,5S,7R,8R)-7-methyl-11-oxo-3-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-4,12-dioxatricyclo[6.3.1.03,5]dodecan-7-yl] acetate |
|---|---|
| PubChem CID | 11733359 |
| Molecular Formula | C25H44O6Si |
| Molecular Weight | 468.71 g/mol |
| Exact Mass | 468.29 |
| IUPAC Name | [(1R,3S,5S,7R,8R)-7-methyl-11-oxo-3-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-4,12-dioxatricyclo[6.3.1.03,5]dodecan-7-yl] acetate |
| SMILES | CC(=O)O[C@]1(C)C[C@@H]2O[C@]2([C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C)C[C@H]2O[C@@H]1CCC2=O |
| InChI | InChI=1S/C25H44O6Si/c1-15(2)32(16(3)4,17(5)6)28-14-18(7)25-12-21-20(27)10-11-22(29-21)24(9,30-19(8)26)13-23(25)31-25/h15-18,21-23H,10-14H2,1-9H3/t18-,21-,22-,23+,24-,25+/m1/s1 |
| InChIKey | UKYOWTXOJHEACR-IMKLBKFXSA-N |
| XLogP | 5.18 |
| TPSA | 74.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.71 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|