C35H70O6Si3 — CID 24786311
(1R,2S,4S,5S,7R,8R)-7-methyl-5,7-bis(triethylsilyloxy)-4-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-3,12-dioxatricyclo[6.3.1.02,4]dodecan-11-one (PubChem CID 24786311) has the molecular formula C35H70O6Si3 and a molecular weight of 671.20 g/mol. Its IUPAC name is (1R,2S,4S,5S,7R,8R)-7-methyl-5,7-bis(triethylsilyloxy)-4-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-3,12-dioxatricyclo[6.3.1.02,4]dodecan-11-one.
| Compound Name | (1R,2S,4S,5S,7R,8R)-7-methyl-5,7-bis(triethylsilyloxy)-4-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-3,12-dioxatricyclo[6.3.1.02,4]dodecan-11-one |
|---|---|
| PubChem CID | 24786311 |
| Molecular Formula | C35H70O6Si3 |
| Molecular Weight | 671.20 g/mol |
| Exact Mass | 670.45 |
| IUPAC Name | (1R,2S,4S,5S,7R,8R)-7-methyl-5,7-bis(triethylsilyloxy)-4-[(2R)-1-tri(propan-2-yl)silyloxypropan-2-yl]-3,12-dioxatricyclo[6.3.1.02,4]dodecan-11-one |
| SMILES | CC[Si](CC)(CC)O[C@H]1C[C@@](C)(O[Si](CC)(CC)CC)[C@H]2CCC(=O)[C@H](O2)[C@@H]2O[C@]12[C@H](C)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C35H70O6Si3/c1-15-42(16-2,17-3)40-31-23-34(14,41-43(18-4,19-5)20-6)30-22-21-29(36)32(38-30)33-35(31,39-33)28(13)24-37-44(25(7)8,26(9)10)27(11)12/h25-28,30-33H,15-24H2,1-14H3/t28-,30-,31+,32+,33+,34-,35-/m1/s1 |
| InChIKey | OULVSXORKSRPMY-CYJUZURMSA-N |
| XLogP | 9.64 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.20 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|