C33H68O6Si3 — CID 54293760
1-[(2S,3R,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2S,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]propan-2-one (PubChem CID 54293760) has the molecular formula C33H68O6Si3 and a molecular weight of 645.16 g/mol. Its IUPAC name is 1-[(2S,3R,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2S,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,3R,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2S,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 54293760 |
| Molecular Formula | C33H68O6Si3 |
| Molecular Weight | 645.16 g/mol |
| Exact Mass | 644.43 |
| IUPAC Name | 1-[(2S,3R,4R,5S)-3,4-bis(triethylsilyloxy)-5-[[(2S,3S)-3-[(2S,3S)-3-triethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]propan-2-one |
| SMILES | CC[Si](CC)(CC)O[C@@H]1[C@@H](C[C@@H]2O[C@H]2[C@H](C)[C@H](C)O[Si](CC)(CC)CC)CO[C@@H](CC(C)=O)[C@H]1O[Si](CC)(CC)CC |
| InChI | InChI=1S/C33H68O6Si3/c1-13-40(14-2,15-3)37-27(12)26(11)31-30(36-31)23-28-24-35-29(22-25(10)34)33(39-42(19-7,20-8)21-9)32(28)38-41(16-4,17-5)18-6/h26-33H,13-24H2,1-12H3/t26-,27+,28+,29+,30+,31+,32-,33-/m1/s1 |
| InChIKey | RZIMKZFFMDOMEB-ANDGNIRLSA-N |
| XLogP | 8.97 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.16 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|