C24H50O6Si3 — CID 10940275
1-[(2S,3S,4R,5S)-3,4-bis(trimethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]propan-2-one (PubChem CID 10940275) has the molecular formula C24H50O6Si3 and a molecular weight of 518.92 g/mol. Its IUPAC name is 1-[(2S,3S,4R,5S)-3,4-bis(trimethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]propan-2-one.
| Compound Name | 1-[(2S,3S,4R,5S)-3,4-bis(trimethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 10940275 |
| Molecular Formula | C24H50O6Si3 |
| Molecular Weight | 518.92 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 1-[(2S,3S,4R,5S)-3,4-bis(trimethylsilyloxy)-5-[[(2S,3S)-3-[(2R,3S)-3-trimethylsilyloxybutan-2-yl]oxiran-2-yl]methyl]oxan-2-yl]propan-2-one |
| SMILES | CC(=O)C[C@@H]1OC[C@H](C[C@@H]2O[C@H]2[C@@H](C)[C@H](C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C24H50O6Si3/c1-16(25)13-20-24(30-33(10,11)12)23(29-32(7,8)9)19(15-26-20)14-21-22(27-21)17(2)18(3)28-31(4,5)6/h17-24H,13-15H2,1-12H3/t17-,18-,19-,20-,21-,22-,23+,24-/m0/s1 |
| InChIKey | USSSZKWVKAHDBL-FNVQBKIFSA-N |
| XLogP | 5.45 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.92 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|