C13H15NO3 — CID 117338027
4-[3-(isocyanatomethyl)phenyl]-2,2-dimethyl-1,3-dioxolane (PubChem CID 117338027) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 4-[3-(isocyanatomethyl)phenyl]-2,2-dimethyl-1,3-dioxolane.
| Compound Name | 4-[3-(isocyanatomethyl)phenyl]-2,2-dimethyl-1,3-dioxolane |
|---|---|
| PubChem CID | 117338027 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 4-[3-(isocyanatomethyl)phenyl]-2,2-dimethyl-1,3-dioxolane |
| SMILES | CC1(C)OCC(c2cccc(CN=C=O)c2)O1 |
| InChI | InChI=1S/C13H15NO3/c1-13(2)16-8-12(17-13)11-5-3-4-10(6-11)7-14-9-15/h3-6,12H,7-8H2,1-2H3 |
| InChIKey | SJLMIMDUWJFISV-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|