C19H20N4O4 — CID 88626829
1,3-bis(isocyanatomethyl)benzene;2,4-diisocyanato-1-methylcyclohexane (PubChem CID 88626829) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is 1,3-bis(isocyanatomethyl)benzene;2,4-diisocyanato-1-methylcyclohexane.
| Compound Name | 1,3-bis(isocyanatomethyl)benzene;2,4-diisocyanato-1-methylcyclohexane |
|---|---|
| PubChem CID | 88626829 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 1,3-bis(isocyanatomethyl)benzene;2,4-diisocyanato-1-methylcyclohexane |
| SMILES | CC1CCC(N=C=O)CC1N=C=O.O=C=NCc1cccc(CN=C=O)c1 |
| InChI | InChI=1S/C10H8N2O2.C9H12N2O2/c13-7-11-5-9-2-1-3-10(4-9)6-12-8-14;1-7-2-3-8(10-5-12)4-9(7)11-6-13/h1-4H,5-6H2;7-9H,2-4H2,1H3 |
| InChIKey | FAJFWFVXKJCBSU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|