About 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid
2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid (PubChem CID 117339801) has the molecular formula C10H9F3O3
and a molecular weight of 234.17 g/mol. Its IUPAC name is 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid.
Analyze 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid?
The IUPAC name of 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid (CID 117339801) is 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid.
What is the SMILES notation for 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid?
The canonical SMILES for 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid is CC(F)(F)c1ccc(F)c(C(O)C(=O)O)c1.
What is the InChIKey of 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid?
The InChIKey is ZVXCCTPNYKUSEM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9F3O3/c1-10(12,13)5-2-3-7(11)6(4-5)8(14)9(15)16/h2-4,8,14H,1H3,(H,15,16).
What are the key properties of 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid?
2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid has a molecular weight of 234.17 g/mol, XLogP of 2.06, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(1,1-difluoroethyl)-2-fluorophenyl]-2-hydroxyacetic acid is sourced from PubChem (CID 117339801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).