C13H11FO3 — CID 117339986
1-(6-fluoro-1-benzofuran-5-yl)cyclobutane-1-carboxylic acid (PubChem CID 117339986) has the molecular formula C13H11FO3 and a molecular weight of 234.23 g/mol. Its IUPAC name is 1-(6-fluoro-1-benzofuran-5-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(6-fluoro-1-benzofuran-5-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117339986 |
| Molecular Formula | C13H11FO3 |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 1-(6-fluoro-1-benzofuran-5-yl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2cc3ccoc3cc2F)CCC1 |
| InChI | InChI=1S/C13H11FO3/c14-10-7-11-8(2-5-17-11)6-9(10)13(12(15)16)3-1-4-13/h2,5-7H,1,3-4H2,(H,15,16) |
| InChIKey | NKVUWEBIACECHC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |