C21H30N6O2S2 — CID 11734201
3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-[5-[[4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazol-3-yl]oxy]pentoxy]-1,2,5-thiadiazole (PubChem CID 11734201) has the molecular formula C21H30N6O2S2 and a molecular weight of 462.65 g/mol. Its IUPAC name is 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-[5-[[4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazol-3-yl]oxy]pentoxy]-1,2,5-thiadiazole.
| Compound Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-[5-[[4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazol-3-yl]oxy]pentoxy]-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 11734201 |
| Molecular Formula | C21H30N6O2S2 |
| Molecular Weight | 462.65 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 3-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-4-[5-[[4-(1-methyl-3,6-dihydro-2H-pyridin-5-yl)-1,2,5-thiadiazol-3-yl]oxy]pentoxy]-1,2,5-thiadiazole |
| SMILES | CN1CCC=C(c2nsnc2OCCCCCOc2nsnc2C2=CCCN(C)C2)C1 |
| InChI | InChI=1S/C21H30N6O2S2/c1-26-10-6-8-16(14-26)18-20(24-30-22-18)28-12-4-3-5-13-29-21-19(23-31-25-21)17-9-7-11-27(2)15-17/h8-9H,3-7,10-15H2,1-2H3 |
| InChIKey | WBZIYZPKFOADIJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 76.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.65 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|