C13H17NO3 — CID 117342217
2-(6,7-dimethyl-1,3-benzodioxol-5-yl)morpholine (PubChem CID 117342217) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 2-(6,7-dimethyl-1,3-benzodioxol-5-yl)morpholine.
| Compound Name | 2-(6,7-dimethyl-1,3-benzodioxol-5-yl)morpholine |
|---|---|
| PubChem CID | 117342217 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 2-(6,7-dimethyl-1,3-benzodioxol-5-yl)morpholine |
| SMILES | Cc1c(C2CNCCO2)cc2c(c1C)OCO2 |
| InChI | InChI=1S/C13H17NO3/c1-8-9(2)13-11(16-7-17-13)5-10(8)12-6-14-3-4-15-12/h5,12,14H,3-4,6-7H2,1-2H3 |
| InChIKey | TXFVWSRVEAEVNL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |