C12H14ClNO3 — CID 117392145
2-(4-chloro-6-methyl-1,3-benzodioxol-5-yl)morpholine (PubChem CID 117392145) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 2-(4-chloro-6-methyl-1,3-benzodioxol-5-yl)morpholine.
| Compound Name | 2-(4-chloro-6-methyl-1,3-benzodioxol-5-yl)morpholine |
|---|---|
| PubChem CID | 117392145 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-(4-chloro-6-methyl-1,3-benzodioxol-5-yl)morpholine |
| SMILES | Cc1cc2c(c(Cl)c1C1CNCCO1)OCO2 |
| InChI | InChI=1S/C12H14ClNO3/c1-7-4-8-12(17-6-16-8)11(13)10(7)9-5-14-2-3-15-9/h4,9,14H,2-3,5-6H2,1H3 |
| InChIKey | JCCOAFXKNCEFKY-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |