C12H14ClNO3 — CID 117392146
2-(6-chloro-4H-1,3-benzodioxin-5-yl)morpholine (PubChem CID 117392146) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is 2-(6-chloro-4H-1,3-benzodioxin-5-yl)morpholine.
| Compound Name | 2-(6-chloro-4H-1,3-benzodioxin-5-yl)morpholine |
|---|---|
| PubChem CID | 117392146 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 2-(6-chloro-4H-1,3-benzodioxin-5-yl)morpholine |
| SMILES | Clc1ccc2c(c1C1CNCCO1)COCO2 |
| InChI | InChI=1S/C12H14ClNO3/c13-9-1-2-10-8(6-15-7-17-10)12(9)11-5-14-3-4-16-11/h1-2,11,14H,3-7H2 |
| InChIKey | SGKHBVGBNQQBQN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |