C12H12BrNO4 — CID 117499066
6-bromo-7-morpholin-2-yl-1,3-benzodioxole-4-carbaldehyde (PubChem CID 117499066) has the molecular formula C12H12BrNO4 and a molecular weight of 314.14 g/mol. Its IUPAC name is 6-bromo-7-morpholin-2-yl-1,3-benzodioxole-4-carbaldehyde.
| Compound Name | 6-bromo-7-morpholin-2-yl-1,3-benzodioxole-4-carbaldehyde |
|---|---|
| PubChem CID | 117499066 |
| Molecular Formula | C12H12BrNO4 |
| Molecular Weight | 314.14 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | 6-bromo-7-morpholin-2-yl-1,3-benzodioxole-4-carbaldehyde |
| SMILES | O=Cc1cc(Br)c(C2CNCCO2)c2c1OCO2 |
| InChI | InChI=1S/C12H12BrNO4/c13-8-3-7(5-15)11-12(18-6-17-11)10(8)9-4-14-1-2-16-9/h3,5,9,14H,1-2,4,6H2 |
| InChIKey | UNMFYSWYIVCODK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.14 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|