C12H13F2NO2 — CID 117354578
2-(4,6-difluoro-2,3-dihydro-1-benzofuran-7-yl)morpholine (PubChem CID 117354578) has the molecular formula C12H13F2NO2 and a molecular weight of 241.24 g/mol. Its IUPAC name is 2-(4,6-difluoro-2,3-dihydro-1-benzofuran-7-yl)morpholine.
| Compound Name | 2-(4,6-difluoro-2,3-dihydro-1-benzofuran-7-yl)morpholine |
|---|---|
| PubChem CID | 117354578 |
| Molecular Formula | C12H13F2NO2 |
| Molecular Weight | 241.24 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-(4,6-difluoro-2,3-dihydro-1-benzofuran-7-yl)morpholine |
| SMILES | Fc1cc(F)c(C2CNCCO2)c2c1CCO2 |
| InChI | InChI=1S/C12H13F2NO2/c13-8-5-9(14)11(10-6-15-2-4-16-10)12-7(8)1-3-17-12/h5,10,15H,1-4,6H2 |
| InChIKey | WZLRRELCHGXCEG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |