About 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde
3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde (PubChem CID 175213091) has the molecular formula C17H19FN2O3
and a molecular weight of 318.35 g/mol. Its IUPAC name is 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde.
Molecular Properties
| Compound Name | 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde |
| PubChem CID | 175213091 |
| Molecular Formula | C17H19FN2O3 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde |
| SMILES | Nc1ccc(C2CNCCO2)c(F)c1.O=Cc1ccccc1O |
| InChI | InChI=1S/C10H13FN2O.C7H6O2/c11-9-5-7(12)1-2-8(9)10-6-13-3-4-14-10;8-5-6-3-1-2-4-7(6)9/h1-2,5,10,13H,3-4,6,12H2;1-5,9H |
| InChIKey | VMXTXZNXQFYASF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde?
The IUPAC name of 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde (CID 175213091) is 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde.
What is the SMILES notation for 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde?
The canonical SMILES for 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde is Nc1ccc(C2CNCCO2)c(F)c1.O=Cc1ccccc1O.
What is the InChIKey of 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde?
The InChIKey is VMXTXZNXQFYASF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13FN2O.C7H6O2/c11-9-5-7(12)1-2-8(9)10-6-13-3-4-14-10;8-5-6-3-1-2-4-7(6)9/h1-2,5,10,13H,3-4,6,12H2;1-5,9H.
What are the key properties of 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde?
3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde has a molecular weight of 318.35 g/mol, XLogP of 2.27, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-morpholin-2-ylaniline;2-hydroxybenzaldehyde is sourced from PubChem (CID 175213091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).